C11H16N2O — CID 131025389
1-cyclobutyl-2-(4,5-dimethylimidazol-1-yl)ethanone (PubChem CID 131025389) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-cyclobutyl-2-(4,5-dimethylimidazol-1-yl)ethanone.
| Compound Name | 1-cyclobutyl-2-(4,5-dimethylimidazol-1-yl)ethanone |
|---|---|
| PubChem CID | 131025389 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-cyclobutyl-2-(4,5-dimethylimidazol-1-yl)ethanone |
| SMILES | Cc1ncn(CC(=O)C2CCC2)c1C |
| InChI | InChI=1S/C11H16N2O/c1-8-9(2)13(7-12-8)6-11(14)10-4-3-5-10/h7,10H,3-6H2,1-2H3 |
| InChIKey | IXAXHCTZKNQCID-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |