C12H18N2O — CID 115769665
1-cyclopentyl-2-(2-ethylimidazol-1-yl)ethanone (PubChem CID 115769665) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-cyclopentyl-2-(2-ethylimidazol-1-yl)ethanone.
| Compound Name | 1-cyclopentyl-2-(2-ethylimidazol-1-yl)ethanone |
|---|---|
| PubChem CID | 115769665 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-cyclopentyl-2-(2-ethylimidazol-1-yl)ethanone |
| SMILES | CCc1nccn1CC(=O)C1CCCC1 |
| InChI | InChI=1S/C12H18N2O/c1-2-12-13-7-8-14(12)9-11(15)10-5-3-4-6-10/h7-8,10H,2-6,9H2,1H3 |
| InChIKey | CZMXXZUCJJICBE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |