C18H19ClN4O4 — CID 7829349
(4-chlorophenyl)methyl 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanoate (PubChem CID 7829349) has the molecular formula C18H19ClN4O4 and a molecular weight of 390.83 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanoate.
| Compound Name | (4-chlorophenyl)methyl 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanoate |
|---|---|
| PubChem CID | 7829349 |
| Molecular Formula | C18H19ClN4O4 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (4-chlorophenyl)methyl 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanoate |
| SMILES | Cn1c(=O)c2c(ncn2CCCC(=O)OCc2ccc(Cl)cc2)n(C)c1=O |
| InChI | InChI=1S/C18H19ClN4O4/c1-21-16-15(17(25)22(2)18(21)26)23(11-20-16)9-3-4-14(24)27-10-12-5-7-13(19)8-6-12/h5-8,11H,3-4,9-10H2,1-2H3 |
| InChIKey | DEASZULGGOJDIL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |