C19H19N5O4S — CID 7829319
1,3-benzothiazol-2-ylmethyl 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanoate (PubChem CID 7829319) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanoate |
|---|---|
| PubChem CID | 7829319 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 4-(1,3-dimethyl-2,6-dioxopurin-7-yl)butanoate |
| SMILES | Cn1c(=O)c2c(ncn2CCCC(=O)OCc2nc3ccccc3s2)n(C)c1=O |
| InChI | InChI=1S/C19H19N5O4S/c1-22-17-16(18(26)23(2)19(22)27)24(11-20-17)9-5-8-15(25)28-10-14-21-12-6-3-4-7-13(12)29-14/h3-4,6-7,11H,5,8-10H2,1-2H3 |
| InChIKey | AGKHPKWFJPBYEH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 101.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |