C15H19Cl2N3O2 — CID 154585641
ethyl 7-(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)heptanoate (PubChem CID 154585641) has the molecular formula C15H19Cl2N3O2 and a molecular weight of 344.24 g/mol. Its IUPAC name is ethyl 7-(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)heptanoate.
| Compound Name | ethyl 7-(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)heptanoate |
|---|---|
| PubChem CID | 154585641 |
| Molecular Formula | C15H19Cl2N3O2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | ethyl 7-(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)heptanoate |
| SMILES | CCOC(=O)CCCCCCn1ccc2c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C15H19Cl2N3O2/c1-2-22-12(21)7-5-3-4-6-9-20-10-8-11-13(16)18-15(17)19-14(11)20/h8,10H,2-7,9H2,1H3 |
| InChIKey | MNUGXBHJXYSSGK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|