C13H23N6O6P — CID 57189228
3-(2,6-diaminopurin-9-yl)oxy-3-(diethoxyphosphorylmethoxy)propan-1-ol (PubChem CID 57189228) has the molecular formula C13H23N6O6P and a molecular weight of 390.34 g/mol. Its IUPAC name is 3-(2,6-diaminopurin-9-yl)oxy-3-(diethoxyphosphorylmethoxy)propan-1-ol.
| Compound Name | 3-(2,6-diaminopurin-9-yl)oxy-3-(diethoxyphosphorylmethoxy)propan-1-ol |
|---|---|
| PubChem CID | 57189228 |
| Molecular Formula | C13H23N6O6P |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 3-(2,6-diaminopurin-9-yl)oxy-3-(diethoxyphosphorylmethoxy)propan-1-ol |
| SMILES | CCOP(=O)(COC(CCO)On1cnc2c(N)nc(N)nc21)OCC |
| InChI | InChI=1S/C13H23N6O6P/c1-3-23-26(21,24-4-2)8-22-9(5-6-20)25-19-7-16-10-11(14)17-13(15)18-12(10)19/h7,9,20H,3-6,8H2,1-2H3,(H4,14,15,17,18) |
| InChIKey | XPLYPTLEUQNCLV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 169.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|