C21H41N5O2Si2 — CID 12994167
9-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]purin-6-amine (PubChem CID 12994167) has the molecular formula C21H41N5O2Si2 and a molecular weight of 451.76 g/mol. Its IUPAC name is 9-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]purin-6-amine.
| Compound Name | 9-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]purin-6-amine |
|---|---|
| PubChem CID | 12994167 |
| Molecular Formula | C21H41N5O2Si2 |
| Molecular Weight | 451.76 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 9-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]purin-6-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CCn1cnc2c(N)ncnc21)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H41N5O2Si2/c1-20(2,3)29(7,8)27-13-16(28-30(9,10)21(4,5)6)11-12-26-15-25-17-18(22)23-14-24-19(17)26/h14-16H,11-13H2,1-10H3,(H2,22,23,24) |
| InChIKey | RNDYEVDGGNCGGN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.76 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|