C9H14N6O — CID 67932489
9-[2-(methoxymethylamino)ethyl]purin-6-amine (PubChem CID 67932489) has the molecular formula C9H14N6O and a molecular weight of 222.25 g/mol. Its IUPAC name is 9-[2-(methoxymethylamino)ethyl]purin-6-amine.
| Compound Name | 9-[2-(methoxymethylamino)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 67932489 |
| Molecular Formula | C9H14N6O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 9-[2-(methoxymethylamino)ethyl]purin-6-amine |
| SMILES | COCNCCn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C9H14N6O/c1-16-6-11-2-3-15-5-14-7-8(10)12-4-13-9(7)15/h4-5,11H,2-3,6H2,1H3,(H2,10,12,13) |
| InChIKey | RMSSDSCXISRQNE-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|