C15H16N6O2 — CID 2815795
9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine (PubChem CID 2815795) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine.
| Compound Name | 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 2815795 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2CCNCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H16N6O2/c16-14-13-15(19-7-18-14)21(8-20-13)4-3-17-6-10-1-2-11-12(5-10)23-9-22-11/h1-2,5,7-8,17H,3-4,6,9H2,(H2,16,18,19) |
| InChIKey | KZLVTBHCHYRPQJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|