About 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine
9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine (PubChem CID 2815795) has the molecular formula C15H16N6O2
and a molecular weight of 312.33 g/mol. Its IUPAC name is 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine.
Molecular Properties
| Compound Name | 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine |
| PubChem CID | 2815795 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2CCNCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H16N6O2/c16-14-13-15(19-7-18-14)21(8-20-13)4-3-17-6-10-1-2-11-12(5-10)23-9-22-11/h1-2,5,7-8,17H,3-4,6,9H2,(H2,16,18,19) |
| InChIKey | KZLVTBHCHYRPQJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine?
The IUPAC name of 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine (CID 2815795) is 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine.
What is the SMILES notation for 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine?
The canonical SMILES for 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine is Nc1ncnc2c1ncn2CCNCc1ccc2c(c1)OCO2.
What is the InChIKey of 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine?
The InChIKey is KZLVTBHCHYRPQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N6O2/c16-14-13-15(19-7-18-14)21(8-20-13)4-3-17-6-10-1-2-11-12(5-10)23-9-22-11/h1-2,5,7-8,17H,3-4,6,9H2,(H2,16,18,19).
What are the key properties of 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine?
9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine has a molecular weight of 312.33 g/mol, XLogP of 0.93, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2-(1,3-benzodioxol-5-ylmethylamino)ethyl]purin-6-amine is sourced from PubChem (CID 2815795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).