C13H13ClN6 — CID 102663266
9-[[4-(aminomethyl)-2-chlorophenyl]methyl]purin-6-amine (PubChem CID 102663266) has the molecular formula C13H13ClN6 and a molecular weight of 288.74 g/mol. Its IUPAC name is 9-[[4-(aminomethyl)-2-chlorophenyl]methyl]purin-6-amine.
| Compound Name | 9-[[4-(aminomethyl)-2-chlorophenyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 102663266 |
| Molecular Formula | C13H13ClN6 |
| Molecular Weight | 288.74 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 9-[[4-(aminomethyl)-2-chlorophenyl]methyl]purin-6-amine |
| SMILES | NCc1ccc(Cn2cnc3c(N)ncnc32)c(Cl)c1 |
| InChI | InChI=1S/C13H13ClN6/c14-10-3-8(4-15)1-2-9(10)5-20-7-19-11-12(16)17-6-18-13(11)20/h1-3,6-7H,4-5,15H2,(H2,16,17,18) |
| InChIKey | FXJPQXFRMOJUPW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.74 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |