C13H11ClN6O — CID 102669744
4-[(6-aminopurin-9-yl)methyl]-3-chlorobenzamide (PubChem CID 102669744) has the molecular formula C13H11ClN6O and a molecular weight of 302.73 g/mol. Its IUPAC name is 4-[(6-aminopurin-9-yl)methyl]-3-chlorobenzamide.
| Compound Name | 4-[(6-aminopurin-9-yl)methyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 102669744 |
| Molecular Formula | C13H11ClN6O |
| Molecular Weight | 302.73 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 4-[(6-aminopurin-9-yl)methyl]-3-chlorobenzamide |
| SMILES | NC(=O)c1ccc(Cn2cnc3c(N)ncnc32)c(Cl)c1 |
| InChI | InChI=1S/C13H11ClN6O/c14-9-3-7(12(16)21)1-2-8(9)4-20-6-19-10-11(15)17-5-18-13(10)20/h1-3,5-6H,4H2,(H2,16,21)(H2,15,17,18) |
| InChIKey | QAICUERIELCQDR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.73 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |