C23H20ClN7O — CID 129244563
N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-4-methylbenzamide (PubChem CID 129244563) has the molecular formula C23H20ClN7O and a molecular weight of 445.91 g/mol. Its IUPAC name is N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-4-methylbenzamide.
| Compound Name | N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 129244563 |
| Molecular Formula | C23H20ClN7O |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2cc3cc(Cl)cc(Cn4cnc5c(N)ncnc54)c3[nH]2)cc1 |
| InChI | InChI=1S/C23H20ClN7O/c1-13-2-4-14(5-3-13)23(32)26-9-18-8-15-6-17(24)7-16(19(15)30-18)10-31-12-29-20-21(25)27-11-28-22(20)31/h2-8,11-12,30H,9-10H2,1H3,(H,26,32)(H2,25,27,28) |
| InChIKey | CSTUDUOPAOGICG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |