C23H17ClN8O — CID 129244569
N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-4-cyanobenzamide (PubChem CID 129244569) has the molecular formula C23H17ClN8O and a molecular weight of 456.90 g/mol. Its IUPAC name is N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-4-cyanobenzamide.
| Compound Name | N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-4-cyanobenzamide |
|---|---|
| PubChem CID | 129244569 |
| Molecular Formula | C23H17ClN8O |
| Molecular Weight | 456.90 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-4-cyanobenzamide |
| SMILES | N#Cc1ccc(C(=O)NCc2cc3cc(Cl)cc(Cn4cnc5c(N)ncnc54)c3[nH]2)cc1 |
| InChI | InChI=1S/C23H17ClN8O/c24-17-5-15-7-18(9-27-23(33)14-3-1-13(8-25)2-4-14)31-19(15)16(6-17)10-32-12-30-20-21(26)28-11-29-22(20)32/h1-7,11-12,31H,9-10H2,(H,27,33)(H2,26,28,29) |
| InChIKey | YPXZQEDVDNPPRR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 138.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.90 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |