C22H18N8 — CID 129244366
4-[2-(aminomethyl)-7-[(6-aminopurin-9-yl)methyl]-1H-indol-4-yl]benzonitrile (PubChem CID 129244366) has the molecular formula C22H18N8 and a molecular weight of 394.44 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-7-[(6-aminopurin-9-yl)methyl]-1H-indol-4-yl]benzonitrile.
| Compound Name | 4-[2-(aminomethyl)-7-[(6-aminopurin-9-yl)methyl]-1H-indol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 129244366 |
| Molecular Formula | C22H18N8 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 4-[2-(aminomethyl)-7-[(6-aminopurin-9-yl)methyl]-1H-indol-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(Cn3cnc4c(N)ncnc43)c3[nH]c(CN)cc23)cc1 |
| InChI | InChI=1S/C22H18N8/c23-8-13-1-3-14(4-2-13)17-6-5-15(19-18(17)7-16(9-24)29-19)10-30-12-28-20-21(25)26-11-27-22(20)30/h1-7,11-12,29H,9-10,24H2,(H2,25,26,27) |
| InChIKey | CEIQTBUDCMVCMC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |