C19H17N9 — CID 129244621
9-[[2-(aminomethyl)-5-pyrimidin-5-yl-1H-indol-7-yl]methyl]purin-6-amine (PubChem CID 129244621) has the molecular formula C19H17N9 and a molecular weight of 371.41 g/mol. Its IUPAC name is 9-[[2-(aminomethyl)-5-pyrimidin-5-yl-1H-indol-7-yl]methyl]purin-6-amine.
| Compound Name | 9-[[2-(aminomethyl)-5-pyrimidin-5-yl-1H-indol-7-yl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 129244621 |
| Molecular Formula | C19H17N9 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 9-[[2-(aminomethyl)-5-pyrimidin-5-yl-1H-indol-7-yl]methyl]purin-6-amine |
| SMILES | NCc1cc2cc(-c3cncnc3)cc(Cn3cnc4c(N)ncnc43)c2[nH]1 |
| InChI | InChI=1S/C19H17N9/c20-4-15-3-12-1-11(14-5-22-8-23-6-14)2-13(16(12)27-15)7-28-10-26-17-18(21)24-9-25-19(17)28/h1-3,5-6,8-10,27H,4,7,20H2,(H2,21,24,25) |
| InChIKey | PJGAUYLSGINVEY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 137.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |