C21H24ClN7O2 — CID 140791648
tert-butyl 2-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methylamino]acetate (PubChem CID 140791648) has the molecular formula C21H24ClN7O2 and a molecular weight of 441.92 g/mol. Its IUPAC name is tert-butyl 2-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methylamino]acetate.
| Compound Name | tert-butyl 2-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methylamino]acetate |
|---|---|
| PubChem CID | 140791648 |
| Molecular Formula | C21H24ClN7O2 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | tert-butyl 2-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methylamino]acetate |
| SMILES | CC(C)(C)OC(=O)CNCc1cc2cc(Cl)cc(Cn3cnc4c(N)ncnc43)c2[nH]1 |
| InChI | InChI=1S/C21H24ClN7O2/c1-21(2,3)31-16(30)8-24-7-15-6-12-4-14(22)5-13(17(12)28-15)9-29-11-27-18-19(23)25-10-26-20(18)29/h4-6,10-11,24,28H,7-9H2,1-3H3,(H2,23,25,26) |
| InChIKey | VMGGNCBGUWMLTM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |