C17H17N7 — CID 129244314
9-[[2-(aminomethyl)-5-ethenyl-1H-indol-7-yl]methyl]purin-6-amine (PubChem CID 129244314) has the molecular formula C17H17N7 and a molecular weight of 319.37 g/mol. Its IUPAC name is 9-[[2-(aminomethyl)-5-ethenyl-1H-indol-7-yl]methyl]purin-6-amine.
| Compound Name | 9-[[2-(aminomethyl)-5-ethenyl-1H-indol-7-yl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 129244314 |
| Molecular Formula | C17H17N7 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 9-[[2-(aminomethyl)-5-ethenyl-1H-indol-7-yl]methyl]purin-6-amine |
| SMILES | C=Cc1cc(Cn2cnc3c(N)ncnc32)c2[nH]c(CN)cc2c1 |
| InChI | InChI=1S/C17H17N7/c1-2-10-3-11-5-13(6-18)23-14(11)12(4-10)7-24-9-22-15-16(19)20-8-21-17(15)24/h2-5,8-9,23H,1,6-7,18H2,(H2,19,20,21) |
| InChIKey | PHSGDRXBVGUHJJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |