C16H13ClN6O — CID 129244342
1-[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]ethanone (PubChem CID 129244342) has the molecular formula C16H13ClN6O and a molecular weight of 340.77 g/mol. Its IUPAC name is 1-[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]ethanone.
| Compound Name | 1-[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]ethanone |
|---|---|
| PubChem CID | 129244342 |
| Molecular Formula | C16H13ClN6O |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 1-[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]ethanone |
| SMILES | CC(=O)c1cc2cc(Cl)cc(Cn3cnc4c(N)ncnc43)c2[nH]1 |
| InChI | InChI=1S/C16H13ClN6O/c1-8(24)12-4-9-2-11(17)3-10(13(9)22-12)5-23-7-21-14-15(18)19-6-20-16(14)23/h2-4,6-7,22H,5H2,1H3,(H2,18,19,20) |
| InChIKey | DBWSVESDWIQOTM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |