C19H20ClN7O — CID 129244077
N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]butanamide (PubChem CID 129244077) has the molecular formula C19H20ClN7O and a molecular weight of 397.87 g/mol. Its IUPAC name is N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]butanamide.
| Compound Name | N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 129244077 |
| Molecular Formula | C19H20ClN7O |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]butanamide |
| SMILES | CCCC(=O)NCc1cc2cc(Cl)cc(Cn3cnc4c(N)ncnc43)c2[nH]1 |
| InChI | InChI=1S/C19H20ClN7O/c1-2-3-15(28)22-7-14-6-11-4-13(20)5-12(16(11)26-14)8-27-10-25-17-18(21)23-9-24-19(17)27/h4-6,9-10,26H,2-3,7-8H2,1H3,(H,22,28)(H2,21,23,24) |
| InChIKey | OHAOUSRTNSNQOR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |