C22H17ClFN7O — CID 129243958
N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-4-fluorobenzamide (PubChem CID 129243958) has the molecular formula C22H17ClFN7O and a molecular weight of 449.88 g/mol. Its IUPAC name is N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-4-fluorobenzamide.
| Compound Name | N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 129243958 |
| Molecular Formula | C22H17ClFN7O |
| Molecular Weight | 449.88 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-4-fluorobenzamide |
| SMILES | Nc1ncnc2c1ncn2Cc1cc(Cl)cc2cc(CNC(=O)c3ccc(F)cc3)[nH]c12 |
| InChI | InChI=1S/C22H17ClFN7O/c23-15-5-13-7-17(8-26-22(32)12-1-3-16(24)4-2-12)30-18(13)14(6-15)9-31-11-29-19-20(25)27-10-28-21(19)31/h1-7,10-11,30H,8-9H2,(H,26,32)(H2,25,27,28) |
| InChIKey | FKIUOFUVELMNCK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.88 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |