C27H25ClN8O — CID 129244036
N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-1,2,3-trimethylindole-5-carboxamide (PubChem CID 129244036) has the molecular formula C27H25ClN8O and a molecular weight of 513.01 g/mol. Its IUPAC name is N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-1,2,3-trimethylindole-5-carboxamide.
| Compound Name | N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-1,2,3-trimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 129244036 |
| Molecular Formula | C27H25ClN8O |
| Molecular Weight | 513.01 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | N-[[7-[(6-aminopurin-9-yl)methyl]-5-chloro-1H-indol-2-yl]methyl]-1,2,3-trimethylindole-5-carboxamide |
| SMILES | Cc1c(C)n(C)c2ccc(C(=O)NCc3cc4cc(Cl)cc(Cn5cnc6c(N)ncnc65)c4[nH]3)cc12 |
| InChI | InChI=1S/C27H25ClN8O/c1-14-15(2)35(3)22-5-4-16(9-21(14)22)27(37)30-10-20-8-17-6-19(28)7-18(23(17)34-20)11-36-13-33-24-25(29)31-12-32-26(24)36/h4-9,12-13,34H,10-11H2,1-3H3,(H,30,37)(H2,29,31,32) |
| InChIKey | QUFQIKNBFOXNEZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.01 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|