C21H19N7 — CID 129244413
9-[[2-(aminomethyl)-5-phenyl-1H-indol-7-yl]methyl]purin-6-amine (PubChem CID 129244413) has the molecular formula C21H19N7 and a molecular weight of 369.43 g/mol. Its IUPAC name is 9-[[2-(aminomethyl)-5-phenyl-1H-indol-7-yl]methyl]purin-6-amine.
| Compound Name | 9-[[2-(aminomethyl)-5-phenyl-1H-indol-7-yl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 129244413 |
| Molecular Formula | C21H19N7 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 9-[[2-(aminomethyl)-5-phenyl-1H-indol-7-yl]methyl]purin-6-amine |
| SMILES | NCc1cc2cc(-c3ccccc3)cc(Cn3cnc4c(N)ncnc43)c2[nH]1 |
| InChI | InChI=1S/C21H19N7/c22-9-17-8-15-6-14(13-4-2-1-3-5-13)7-16(18(15)27-17)10-28-12-26-19-20(23)24-11-25-21(19)28/h1-8,11-12,27H,9-10,22H2,(H2,23,24,25) |
| InChIKey | OEJCCKGUKJDFAE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |