C22H18N6 — CID 67200292
9-[(8-methyl-2-phenylquinolin-3-yl)methyl]purin-6-amine (PubChem CID 67200292) has the molecular formula C22H18N6 and a molecular weight of 366.43 g/mol. Its IUPAC name is 9-[(8-methyl-2-phenylquinolin-3-yl)methyl]purin-6-amine.
| Compound Name | 9-[(8-methyl-2-phenylquinolin-3-yl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 67200292 |
| Molecular Formula | C22H18N6 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 9-[(8-methyl-2-phenylquinolin-3-yl)methyl]purin-6-amine |
| SMILES | Cc1cccc2cc(Cn3cnc4c(N)ncnc43)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C22H18N6/c1-14-6-5-9-16-10-17(19(27-18(14)16)15-7-3-2-4-8-15)11-28-13-26-20-21(23)24-12-25-22(20)28/h2-10,12-13H,11H2,1H3,(H2,23,24,25) |
| InChIKey | DPBGGDNCPVEYJS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |