C12H11N5O2S — CID 80730598
4-[(6-aminopurin-9-yl)methyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 80730598) has the molecular formula C12H11N5O2S and a molecular weight of 289.32 g/mol. Its IUPAC name is 4-[(6-aminopurin-9-yl)methyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[(6-aminopurin-9-yl)methyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 80730598 |
| Molecular Formula | C12H11N5O2S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 4-[(6-aminopurin-9-yl)methyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C12H11N5O2S/c1-6-7(2-8(20-6)12(18)19)3-17-5-16-9-10(13)14-4-15-11(9)17/h2,4-5H,3H2,1H3,(H,18,19)(H2,13,14,15) |
| InChIKey | LHVORXNBWLKRKD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |