C11H11N7OS — CID 63580583
5-[(6-aminopurin-9-yl)methyl]thiophene-2-carbohydrazide (PubChem CID 63580583) has the molecular formula C11H11N7OS and a molecular weight of 289.32 g/mol. Its IUPAC name is 5-[(6-aminopurin-9-yl)methyl]thiophene-2-carbohydrazide.
| Compound Name | 5-[(6-aminopurin-9-yl)methyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 63580583 |
| Molecular Formula | C11H11N7OS |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 5-[(6-aminopurin-9-yl)methyl]thiophene-2-carbohydrazide |
| SMILES | NNC(=O)c1ccc(Cn2cnc3c(N)ncnc32)s1 |
| InChI | InChI=1S/C11H11N7OS/c12-9-8-10(15-4-14-9)18(5-16-8)3-6-1-2-7(20-6)11(19)17-13/h1-2,4-5H,3,13H2,(H,17,19)(H2,12,14,15) |
| InChIKey | OIWMIHARLLVQME-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|