C11H8N6OS — CID 112595889
5-[(4,5-dicyanoimidazol-1-yl)methyl]thiophene-2-carbohydrazide (PubChem CID 112595889) has the molecular formula C11H8N6OS and a molecular weight of 272.29 g/mol. Its IUPAC name is 5-[(4,5-dicyanoimidazol-1-yl)methyl]thiophene-2-carbohydrazide.
| Compound Name | 5-[(4,5-dicyanoimidazol-1-yl)methyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 112595889 |
| Molecular Formula | C11H8N6OS |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 5-[(4,5-dicyanoimidazol-1-yl)methyl]thiophene-2-carbohydrazide |
| SMILES | N#Cc1ncn(Cc2ccc(C(=O)NN)s2)c1C#N |
| InChI | InChI=1S/C11H8N6OS/c12-3-8-9(4-13)17(6-15-8)5-7-1-2-10(19-7)11(18)16-14/h1-2,6H,5,14H2,(H,16,18) |
| InChIKey | UBUBWBOGMHOSCU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|