C10H7N7O2 — CID 112595905
5-[(4,5-dicyanoimidazol-1-yl)methyl]-1,2-oxazole-3-carbohydrazide (PubChem CID 112595905) has the molecular formula C10H7N7O2 and a molecular weight of 257.21 g/mol. Its IUPAC name is 5-[(4,5-dicyanoimidazol-1-yl)methyl]-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-[(4,5-dicyanoimidazol-1-yl)methyl]-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 112595905 |
| Molecular Formula | C10H7N7O2 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 5-[(4,5-dicyanoimidazol-1-yl)methyl]-1,2-oxazole-3-carbohydrazide |
| SMILES | N#Cc1ncn(Cc2cc(C(=O)NN)no2)c1C#N |
| InChI | InChI=1S/C10H7N7O2/c11-2-8-9(3-12)17(5-14-8)4-6-1-7(16-19-6)10(18)15-13/h1,5H,4,13H2,(H,15,18) |
| InChIKey | UNDDGOSKYJHYCI-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 146.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|