C8H4N4 — CID 112595691
1-prop-2-ynylimidazole-4,5-dicarbonitrile (PubChem CID 112595691) has the molecular formula C8H4N4 and a molecular weight of 156.15 g/mol. Its IUPAC name is 1-prop-2-ynylimidazole-4,5-dicarbonitrile.
| Compound Name | 1-prop-2-ynylimidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 112595691 |
| Molecular Formula | C8H4N4 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 1-prop-2-ynylimidazole-4,5-dicarbonitrile |
| SMILES | C#CCn1cnc(C#N)c1C#N |
| InChI | InChI=1S/C8H4N4/c1-2-3-12-6-11-7(4-9)8(12)5-10/h1,6H,3H2 |
| InChIKey | YJXUJTXVGJOULA-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|