C8H8N4O — CID 112595298
1-(2-hydroxypropyl)imidazole-4,5-dicarbonitrile (PubChem CID 112595298) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is 1-(2-hydroxypropyl)imidazole-4,5-dicarbonitrile.
| Compound Name | 1-(2-hydroxypropyl)imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 112595298 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 1-(2-hydroxypropyl)imidazole-4,5-dicarbonitrile |
| SMILES | CC(O)Cn1cnc(C#N)c1C#N |
| InChI | InChI=1S/C8H8N4O/c1-6(13)4-12-5-11-7(2-9)8(12)3-10/h5-6,13H,4H2,1H3 |
| InChIKey | QYWMAHKRWYKMGT-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 85.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |