C8H9N5 — CID 102689223
1-(2-aminopropyl)imidazole-4,5-dicarbonitrile (PubChem CID 102689223) has the molecular formula C8H9N5 and a molecular weight of 175.19 g/mol. Its IUPAC name is 1-(2-aminopropyl)imidazole-4,5-dicarbonitrile.
| Compound Name | 1-(2-aminopropyl)imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 102689223 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 1-(2-aminopropyl)imidazole-4,5-dicarbonitrile |
| SMILES | CC(N)Cn1cnc(C#N)c1C#N |
| InChI | InChI=1S/C8H9N5/c1-6(11)4-13-5-12-7(2-9)8(13)3-10/h5-6H,4,11H2,1H3 |
| InChIKey | SQCSLUVXTIMRMK-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |