C14H12N4S — CID 112595930
1-(2-phenyl-3-sulfanylpropyl)imidazole-4,5-dicarbonitrile (PubChem CID 112595930) has the molecular formula C14H12N4S and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-(2-phenyl-3-sulfanylpropyl)imidazole-4,5-dicarbonitrile.
| Compound Name | 1-(2-phenyl-3-sulfanylpropyl)imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 112595930 |
| Molecular Formula | C14H12N4S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1-(2-phenyl-3-sulfanylpropyl)imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(CC(CS)c2ccccc2)c1C#N |
| InChI | InChI=1S/C14H12N4S/c15-6-13-14(7-16)18(10-17-13)8-12(9-19)11-4-2-1-3-5-11/h1-5,10,12,19H,8-9H2 |
| InChIKey | PCSXHKWEOVIKQL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|