2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid

C13H8N4O2 — CID 112594969

IUPAC2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid
SMILESN#Cc1ncn(C(C(=O)O)c2ccccc2)c1C#N
InChIInChI=1S/C13H8N4O2/c14-6-10-11(7-15)17(8-16-10)12(13(18)19)9-4-2-1-3-5-9/h1-5,8,12H,(H,18,19)
InChIKeyCJSSUYHBKYOZRZ-UHFFFAOYSA-N
MW252.23 g/mol
LogP1.30
Rot. Bonds3

About 2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid

2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid (PubChem CID 112594969) has the molecular formula C13H8N4O2 and a molecular weight of 252.23 g/mol. Its IUPAC name is 2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid.

Molecular Properties

Compound Name2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid
PubChem CID112594969
Molecular FormulaC13H8N4O2
Molecular Weight252.23 g/mol
Exact Mass252.06
IUPAC Name2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid
SMILESN#Cc1ncn(C(C(=O)O)c2ccccc2)c1C#N
InChIInChI=1S/C13H8N4O2/c14-6-10-11(7-15)17(8-16-10)12(13(18)19)9-4-2-1-3-5-9/h1-5,8,12H,(H,18,19)
InChIKeyCJSSUYHBKYOZRZ-UHFFFAOYSA-N
XLogP1.30
TPSA102.70 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.23
LogP ≤ 51.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid?
The IUPAC name of 2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid (CID 112594969) is 2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid.
What is the SMILES notation for 2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid?
The canonical SMILES for 2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid is N#Cc1ncn(C(C(=O)O)c2ccccc2)c1C#N.
What is the InChIKey of 2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid?
The InChIKey is CJSSUYHBKYOZRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N4O2/c14-6-10-11(7-15)17(8-16-10)12(13(18)19)9-4-2-1-3-5-9/h1-5,8,12H,(H,18,19).
What are the key properties of 2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid?
2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid has a molecular weight of 252.23 g/mol, XLogP of 1.30, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid is sourced from PubChem (CID 112594969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).