C13H8N4O2 — CID 112594969
2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid (PubChem CID 112594969) has the molecular formula C13H8N4O2 and a molecular weight of 252.23 g/mol. Its IUPAC name is 2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid.
| Compound Name | 2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid |
|---|---|
| PubChem CID | 112594969 |
| Molecular Formula | C13H8N4O2 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-(4,5-dicyanoimidazol-1-yl)-2-phenylacetic acid |
| SMILES | N#Cc1ncn(C(C(=O)O)c2ccccc2)c1C#N |
| InChI | InChI=1S/C13H8N4O2/c14-6-10-11(7-15)17(8-16-10)12(13(18)19)9-4-2-1-3-5-9/h1-5,8,12H,(H,18,19) |
| InChIKey | CJSSUYHBKYOZRZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |