C10H12N4 — CID 107887293
1-pentan-2-ylimidazole-4,5-dicarbonitrile (PubChem CID 107887293) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 1-pentan-2-ylimidazole-4,5-dicarbonitrile.
| Compound Name | 1-pentan-2-ylimidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 107887293 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 1-pentan-2-ylimidazole-4,5-dicarbonitrile |
| SMILES | CCCC(C)n1cnc(C#N)c1C#N |
| InChI | InChI=1S/C10H12N4/c1-3-4-8(2)14-7-13-9(5-11)10(14)6-12/h7-8H,3-4H2,1-2H3 |
| InChIKey | RBLOCFBMZNYFGC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |