C9H8N4O — CID 112595248
1-(3-oxobutan-2-yl)imidazole-4,5-dicarbonitrile (PubChem CID 112595248) has the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. Its IUPAC name is 1-(3-oxobutan-2-yl)imidazole-4,5-dicarbonitrile.
| Compound Name | 1-(3-oxobutan-2-yl)imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 112595248 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 1-(3-oxobutan-2-yl)imidazole-4,5-dicarbonitrile |
| SMILES | CC(=O)C(C)n1cnc(C#N)c1C#N |
| InChI | InChI=1S/C9H8N4O/c1-6(7(2)14)13-5-12-8(3-10)9(13)4-11/h5-6H,1-2H3 |
| InChIKey | GWAIDPXYAMHBAT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 82.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |