About 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile
1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile (PubChem CID 12947421) has the molecular formula C13H8Cl2N4
and a molecular weight of 291.14 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile |
| PubChem CID | 12947421 |
| Molecular Formula | C13H8Cl2N4 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile |
| SMILES | CC(c1ccc(Cl)c(Cl)c1)n1cnc(C#N)c1C#N |
| InChI | InChI=1S/C13H8Cl2N4/c1-8(9-2-3-10(14)11(15)4-9)19-7-18-12(5-16)13(19)6-17/h2-4,7-8H,1H3 |
| InChIKey | UPEYWGJBRLRKGU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile?
The IUPAC name of 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile (CID 12947421) is 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile.
What is the SMILES notation for 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile?
The canonical SMILES for 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile is CC(c1ccc(Cl)c(Cl)c1)n1cnc(C#N)c1C#N.
What is the InChIKey of 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile?
The InChIKey is UPEYWGJBRLRKGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2N4/c1-8(9-2-3-10(14)11(15)4-9)19-7-18-12(5-16)13(19)6-17/h2-4,7-8H,1H3.
What are the key properties of 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile?
1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile has a molecular weight of 291.14 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3,4-dichlorophenyl)ethyl]imidazole-4,5-dicarbonitrile is sourced from PubChem (CID 12947421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).