C14H20N4 — CID 112595489
1-nonylimidazole-4,5-dicarbonitrile (PubChem CID 112595489) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 1-nonylimidazole-4,5-dicarbonitrile.
| Compound Name | 1-nonylimidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 112595489 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 1-nonylimidazole-4,5-dicarbonitrile |
| SMILES | CCCCCCCCCn1cnc(C#N)c1C#N |
| InChI | InChI=1S/C14H20N4/c1-2-3-4-5-6-7-8-9-18-12-17-13(10-15)14(18)11-16/h12H,2-9H2,1H3 |
| InChIKey | VFBVZIJMEOLIAL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|