C18H11BrN4 — CID 10316619
1-[(2-bromophenyl)-phenylmethyl]imidazole-4,5-dicarbonitrile (PubChem CID 10316619) has the molecular formula C18H11BrN4 and a molecular weight of 363.22 g/mol. Its IUPAC name is 1-[(2-bromophenyl)-phenylmethyl]imidazole-4,5-dicarbonitrile.
| Compound Name | 1-[(2-bromophenyl)-phenylmethyl]imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 10316619 |
| Molecular Formula | C18H11BrN4 |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 1-[(2-bromophenyl)-phenylmethyl]imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(C(c2ccccc2)c2ccccc2Br)c1C#N |
| InChI | InChI=1S/C18H11BrN4/c19-15-9-5-4-8-14(15)18(13-6-2-1-3-7-13)23-12-22-16(10-20)17(23)11-21/h1-9,12,18H |
| InChIKey | HBYCTKUKVYJSKW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |