C16H15BrN2 — CID 10545906
(2R)-2-(2-bromophenyl)-2-[[(1S)-1-phenylethyl]amino]acetonitrile (PubChem CID 10545906) has the molecular formula C16H15BrN2 and a molecular weight of 315.21 g/mol. Its IUPAC name is (2R)-2-(2-bromophenyl)-2-[[(1S)-1-phenylethyl]amino]acetonitrile.
| Compound Name | (2R)-2-(2-bromophenyl)-2-[[(1S)-1-phenylethyl]amino]acetonitrile |
|---|---|
| PubChem CID | 10545906 |
| Molecular Formula | C16H15BrN2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | (2R)-2-(2-bromophenyl)-2-[[(1S)-1-phenylethyl]amino]acetonitrile |
| SMILES | C[C@H](N[C@@H](C#N)c1ccccc1Br)c1ccccc1 |
| InChI | InChI=1S/C16H15BrN2/c1-12(13-7-3-2-4-8-13)19-16(11-18)14-9-5-6-10-15(14)17/h2-10,12,16,19H,1H3/t12-,16-/m0/s1 |
| InChIKey | ZLOWRRUSDJVYKF-LRDDRELGSA-N |
| XLogP | 4.36 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |