C11H7N5 — CID 112595443
1-(pyridin-2-ylmethyl)imidazole-4,5-dicarbonitrile (PubChem CID 112595443) has the molecular formula C11H7N5 and a molecular weight of 209.21 g/mol. Its IUPAC name is 1-(pyridin-2-ylmethyl)imidazole-4,5-dicarbonitrile.
| Compound Name | 1-(pyridin-2-ylmethyl)imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 112595443 |
| Molecular Formula | C11H7N5 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 1-(pyridin-2-ylmethyl)imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(Cc2ccccn2)c1C#N |
| InChI | InChI=1S/C11H7N5/c12-5-10-11(6-13)16(8-15-10)7-9-3-1-2-4-14-9/h1-4,8H,7H2 |
| InChIKey | QATPNZWKEMKWCT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |