About 1-(1,3-thiazol-4-ylmethyl)imidazole-4,5-dicarbonitrile
1-(1,3-thiazol-4-ylmethyl)imidazole-4,5-dicarbonitrile (PubChem CID 112595584) has the molecular formula C9H5N5S
and a molecular weight of 215.24 g/mol. Its IUPAC name is 1-(1,3-thiazol-4-ylmethyl)imidazole-4,5-dicarbonitrile.
Analyze 1-(1,3-thiazol-4-ylmethyl)imidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-thiazol-4-ylmethyl)imidazole-4,5-dicarbonitrile?
The IUPAC name of 1-(1,3-thiazol-4-ylmethyl)imidazole-4,5-dicarbonitrile (CID 112595584) is 1-(1,3-thiazol-4-ylmethyl)imidazole-4,5-dicarbonitrile.
What is the SMILES notation for 1-(1,3-thiazol-4-ylmethyl)imidazole-4,5-dicarbonitrile?
The canonical SMILES for 1-(1,3-thiazol-4-ylmethyl)imidazole-4,5-dicarbonitrile is N#Cc1ncn(Cc2cscn2)c1C#N.
What is the InChIKey of 1-(1,3-thiazol-4-ylmethyl)imidazole-4,5-dicarbonitrile?
The InChIKey is GWFSBKFSTVVQJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N5S/c10-1-8-9(2-11)14(5-12-8)3-7-4-15-6-13-7/h4-6H,3H2.
What are the key properties of 1-(1,3-thiazol-4-ylmethyl)imidazole-4,5-dicarbonitrile?
1-(1,3-thiazol-4-ylmethyl)imidazole-4,5-dicarbonitrile has a molecular weight of 215.24 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-thiazol-4-ylmethyl)imidazole-4,5-dicarbonitrile is sourced from PubChem (CID 112595584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).