C10H6N4S — CID 112595726
1-(thiophen-3-ylmethyl)imidazole-4,5-dicarbonitrile (PubChem CID 112595726) has the molecular formula C10H6N4S and a molecular weight of 214.25 g/mol. Its IUPAC name is 1-(thiophen-3-ylmethyl)imidazole-4,5-dicarbonitrile.
| Compound Name | 1-(thiophen-3-ylmethyl)imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 112595726 |
| Molecular Formula | C10H6N4S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 1-(thiophen-3-ylmethyl)imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(Cc2ccsc2)c1C#N |
| InChI | InChI=1S/C10H6N4S/c11-3-9-10(4-12)14(7-13-9)5-8-1-2-15-6-8/h1-2,6-7H,5H2 |
| InChIKey | DRDPMJQEHFOAMX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |