C12H8BrN5 — CID 103350197
1-[(3-amino-5-bromophenyl)methyl]imidazole-4,5-dicarbonitrile (PubChem CID 103350197) has the molecular formula C12H8BrN5 and a molecular weight of 302.14 g/mol. Its IUPAC name is 1-[(3-amino-5-bromophenyl)methyl]imidazole-4,5-dicarbonitrile.
| Compound Name | 1-[(3-amino-5-bromophenyl)methyl]imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 103350197 |
| Molecular Formula | C12H8BrN5 |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 1-[(3-amino-5-bromophenyl)methyl]imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1ncn(Cc2cc(N)cc(Br)c2)c1C#N |
| InChI | InChI=1S/C12H8BrN5/c13-9-1-8(2-10(16)3-9)6-18-7-17-11(4-14)12(18)5-15/h1-3,7H,6,16H2 |
| InChIKey | LIEDDIKPFYQVJJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|