C13H7N5 — CID 112595123
1-[(3-cyanophenyl)methyl]imidazole-4,5-dicarbonitrile (PubChem CID 112595123) has the molecular formula C13H7N5 and a molecular weight of 233.23 g/mol. Its IUPAC name is 1-[(3-cyanophenyl)methyl]imidazole-4,5-dicarbonitrile.
| Compound Name | 1-[(3-cyanophenyl)methyl]imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 112595123 |
| Molecular Formula | C13H7N5 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 1-[(3-cyanophenyl)methyl]imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1cccc(Cn2cnc(C#N)c2C#N)c1 |
| InChI | InChI=1S/C13H7N5/c14-5-10-2-1-3-11(4-10)8-18-9-17-12(6-15)13(18)7-16/h1-4,9H,8H2 |
| InChIKey | CDTTXBOXWVCSCK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 89.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |