C7H6N4O — CID 15054275
1-(methoxymethyl)imidazole-4,5-dicarbonitrile (PubChem CID 15054275) has the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. Its IUPAC name is 1-(methoxymethyl)imidazole-4,5-dicarbonitrile.
| Compound Name | 1-(methoxymethyl)imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 15054275 |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 1-(methoxymethyl)imidazole-4,5-dicarbonitrile |
| SMILES | COCn1cnc(C#N)c1C#N |
| InChI | InChI=1S/C7H6N4O/c1-12-5-11-4-10-6(2-8)7(11)3-9/h4H,5H2,1H3 |
| InChIKey | MTAVILXFSMOKBB-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 74.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |