C12H16N4S — CID 112595919
1-[2-ethyl-2-(sulfanylmethyl)butyl]imidazole-4,5-dicarbonitrile (PubChem CID 112595919) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 1-[2-ethyl-2-(sulfanylmethyl)butyl]imidazole-4,5-dicarbonitrile.
| Compound Name | 1-[2-ethyl-2-(sulfanylmethyl)butyl]imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 112595919 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1-[2-ethyl-2-(sulfanylmethyl)butyl]imidazole-4,5-dicarbonitrile |
| SMILES | CCC(CC)(CS)Cn1cnc(C#N)c1C#N |
| InChI | InChI=1S/C12H16N4S/c1-3-12(4-2,8-17)7-16-9-15-10(5-13)11(16)6-14/h9,17H,3-4,7-8H2,1-2H3 |
| InChIKey | AGKNKQMHWOQKAR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|