About 1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile
1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile (PubChem CID 60709671) has the molecular formula C9H7N5
and a molecular weight of 185.19 g/mol. Its IUPAC name is 1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile.
Analyze 1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile?
The IUPAC name of 1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile (CID 60709671) is 1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile.
What is the SMILES notation for 1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile?
The canonical SMILES for 1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile is N#Cc1ncn(Cc2ccccn2)n1.
What is the InChIKey of 1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile?
The InChIKey is DKIHBNQZSAXIMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N5/c10-5-9-12-7-14(13-9)6-8-3-1-2-4-11-8/h1-4,7H,6H2.
What are the key properties of 1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile?
1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile has a molecular weight of 185.19 g/mol, XLogP of 0.59, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile is sourced from PubChem (CID 60709671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).