C13H14N4 — CID 117007901
1-(pyridin-2-ylmethyl)piperidine-4,4-dicarbonitrile (PubChem CID 117007901) has the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-(pyridin-2-ylmethyl)piperidine-4,4-dicarbonitrile.
| Compound Name | 1-(pyridin-2-ylmethyl)piperidine-4,4-dicarbonitrile |
|---|---|
| PubChem CID | 117007901 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-(pyridin-2-ylmethyl)piperidine-4,4-dicarbonitrile |
| SMILES | N#CC1(C#N)CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C13H14N4/c14-10-13(11-15)4-7-17(8-5-13)9-12-3-1-2-6-16-12/h1-3,6H,4-5,7-9H2 |
| InChIKey | DBTJTVCPJGSBTC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |