C21H28N4 — CID 97451205
N-methyl-N,7-bis(pyridin-2-ylmethyl)-7-azaspiro[3.5]nonan-2-amine (PubChem CID 97451205) has the molecular formula C21H28N4 and a molecular weight of 336.48 g/mol. Its IUPAC name is N-methyl-N,7-bis(pyridin-2-ylmethyl)-7-azaspiro[3.5]nonan-2-amine.
| Compound Name | N-methyl-N,7-bis(pyridin-2-ylmethyl)-7-azaspiro[3.5]nonan-2-amine |
|---|---|
| PubChem CID | 97451205 |
| Molecular Formula | C21H28N4 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | N-methyl-N,7-bis(pyridin-2-ylmethyl)-7-azaspiro[3.5]nonan-2-amine |
| SMILES | CN(Cc1ccccn1)C1CC2(CCN(Cc3ccccn3)CC2)C1 |
| InChI | InChI=1S/C21H28N4/c1-24(16-18-6-2-4-10-22-18)20-14-21(15-20)8-12-25(13-9-21)17-19-7-3-5-11-23-19/h2-7,10-11,20H,8-9,12-17H2,1H3 |
| InChIKey | ORXQFGVPLZJZNI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |