C16H25N3O2S — CID 97449549
2-ethylsulfonyl-8-(pyridin-2-ylmethyl)-2,8-diazaspiro[4.5]decane (PubChem CID 97449549) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-ethylsulfonyl-8-(pyridin-2-ylmethyl)-2,8-diazaspiro[4.5]decane.
| Compound Name | 2-ethylsulfonyl-8-(pyridin-2-ylmethyl)-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 97449549 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-ethylsulfonyl-8-(pyridin-2-ylmethyl)-2,8-diazaspiro[4.5]decane |
| SMILES | CCS(=O)(=O)N1CCC2(CCN(Cc3ccccn3)CC2)C1 |
| InChI | InChI=1S/C16H25N3O2S/c1-2-22(20,21)19-12-8-16(14-19)6-10-18(11-7-16)13-15-5-3-4-9-17-15/h3-5,9H,2,6-8,10-14H2,1H3 |
| InChIKey | BBWCRTTXSNKEAQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |