C20H25N3O — CID 124965584
(3S)-3,8-bis(pyridin-2-ylmethyl)-2-oxa-8-azaspiro[4.5]decane (PubChem CID 124965584) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (3S)-3,8-bis(pyridin-2-ylmethyl)-2-oxa-8-azaspiro[4.5]decane.
| Compound Name | (3S)-3,8-bis(pyridin-2-ylmethyl)-2-oxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 124965584 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (3S)-3,8-bis(pyridin-2-ylmethyl)-2-oxa-8-azaspiro[4.5]decane |
| SMILES | c1ccc(C[C@@H]2CC3(CCN(Cc4ccccn4)CC3)CO2)nc1 |
| InChI | InChI=1S/C20H25N3O/c1-3-9-21-17(5-1)13-19-14-20(16-24-19)7-11-23(12-8-20)15-18-6-2-4-10-22-18/h1-6,9-10,19H,7-8,11-16H2/t19-/m1/s1 |
| InChIKey | IFVZOZJAWOAYQP-LJQANCHMSA-N |
| XLogP | 3.09 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |